About 5-iodo-1,3,4-oxadiazole-2-carbonitrile
5-iodo-1,3,4-oxadiazole-2-carbonitrile (PubChem CID 118983472) has the molecular formula C3IN3O
and a molecular weight of 220.96 g/mol. Its IUPAC name is 5-iodo-1,3,4-oxadiazole-2-carbonitrile.
Molecular Properties
| Compound Name | 5-iodo-1,3,4-oxadiazole-2-carbonitrile |
| PubChem CID | 118983472 |
| Molecular Formula | C3IN3O |
| Molecular Weight | 220.96 g/mol |
| Exact Mass | 220.91 |
| IUPAC Name | 5-iodo-1,3,4-oxadiazole-2-carbonitrile |
| SMILES | N#Cc1nnc(I)o1 |
| InChI | InChI=1S/C3IN3O/c4-3-7-6-2(1-5)8-3 |
| InChIKey | ZSDGWHKTRBGWKH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.96 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-1,3,4-oxadiazole-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-1,3,4-oxadiazole-2-carbonitrile?
The IUPAC name of 5-iodo-1,3,4-oxadiazole-2-carbonitrile (CID 118983472) is 5-iodo-1,3,4-oxadiazole-2-carbonitrile.
What is the SMILES notation for 5-iodo-1,3,4-oxadiazole-2-carbonitrile?
The canonical SMILES for 5-iodo-1,3,4-oxadiazole-2-carbonitrile is N#Cc1nnc(I)o1.
What is the InChIKey of 5-iodo-1,3,4-oxadiazole-2-carbonitrile?
The InChIKey is ZSDGWHKTRBGWKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3IN3O/c4-3-7-6-2(1-5)8-3.
What are the key properties of 5-iodo-1,3,4-oxadiazole-2-carbonitrile?
5-iodo-1,3,4-oxadiazole-2-carbonitrile has a molecular weight of 220.96 g/mol, XLogP of 0.55, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-1,3,4-oxadiazole-2-carbonitrile is sourced from PubChem (CID 118983472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).