About 1-amino-2-cyclohexa-1,3-dien-1-ylethanol
1-amino-2-cyclohexa-1,3-dien-1-ylethanol (PubChem CID 118984000) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 1-amino-2-cyclohexa-1,3-dien-1-ylethanol.
Molecular Properties
| Compound Name | 1-amino-2-cyclohexa-1,3-dien-1-ylethanol |
| PubChem CID | 118984000 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 1-amino-2-cyclohexa-1,3-dien-1-ylethanol |
| SMILES | NC(O)CC1=CC=CCC1 |
| InChI | InChI=1S/C8H13NO/c9-8(10)6-7-4-2-1-3-5-7/h1-2,4,8,10H,3,5-6,9H2 |
| InChIKey | DXTCQKUDATZNHU-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-2-cyclohexa-1,3-dien-1-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2-cyclohexa-1,3-dien-1-ylethanol?
The IUPAC name of 1-amino-2-cyclohexa-1,3-dien-1-ylethanol (CID 118984000) is 1-amino-2-cyclohexa-1,3-dien-1-ylethanol.
What is the SMILES notation for 1-amino-2-cyclohexa-1,3-dien-1-ylethanol?
The canonical SMILES for 1-amino-2-cyclohexa-1,3-dien-1-ylethanol is NC(O)CC1=CC=CCC1.
What is the InChIKey of 1-amino-2-cyclohexa-1,3-dien-1-ylethanol?
The InChIKey is DXTCQKUDATZNHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c9-8(10)6-7-4-2-1-3-5-7/h1-2,4,8,10H,3,5-6,9H2.
What are the key properties of 1-amino-2-cyclohexa-1,3-dien-1-ylethanol?
1-amino-2-cyclohexa-1,3-dien-1-ylethanol has a molecular weight of 139.20 g/mol, XLogP of 0.93, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2-cyclohexa-1,3-dien-1-ylethanol is sourced from PubChem (CID 118984000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).