C21H26O2 — CID 118984009
(4aR)-4,4,5-trimethyl-3-[(3Z)-penta-1,3-dien-2-yl]oxy-2-prop-2-enyl-4a,8a-dihydronaphthalen-1-one (PubChem CID 118984009) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is (4aR)-4,4,5-trimethyl-3-[(3Z)-penta-1,3-dien-2-yl]oxy-2-prop-2-enyl-4a,8a-dihydronaphthalen-1-one.
| Compound Name | (4aR)-4,4,5-trimethyl-3-[(3Z)-penta-1,3-dien-2-yl]oxy-2-prop-2-enyl-4a,8a-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 118984009 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (4aR)-4,4,5-trimethyl-3-[(3Z)-penta-1,3-dien-2-yl]oxy-2-prop-2-enyl-4a,8a-dihydronaphthalen-1-one |
| SMILES | C=CCC1=C(OC(=C)/C=C\C)C(C)(C)[C@H]2C(C)=CC=CC2C1=O |
| InChI | InChI=1S/C21H26O2/c1-7-10-15(4)23-20-17(11-8-2)19(22)16-13-9-12-14(3)18(16)21(20,5)6/h7-10,12-13,16,18H,2,4,11H2,1,3,5-6H3/b10-7-/t16?,18-/m0/s1 |
| InChIKey | LYDKSATUUUXZHG-OTCKEHBKSA-N |
| XLogP | 5.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|