C13H21F3N2 — CID 118984030
(Z)-2-N-[(1R)-4-ethylcyclohex-3-en-1-yl]-5,5,5-trifluoropent-2-ene-2,4-diamine (PubChem CID 118984030) has the molecular formula C13H21F3N2 and a molecular weight of 262.32 g/mol. Its IUPAC name is (Z)-2-N-[(1R)-4-ethylcyclohex-3-en-1-yl]-5,5,5-trifluoropent-2-ene-2,4-diamine.
| Compound Name | (Z)-2-N-[(1R)-4-ethylcyclohex-3-en-1-yl]-5,5,5-trifluoropent-2-ene-2,4-diamine |
|---|---|
| PubChem CID | 118984030 |
| Molecular Formula | C13H21F3N2 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (Z)-2-N-[(1R)-4-ethylcyclohex-3-en-1-yl]-5,5,5-trifluoropent-2-ene-2,4-diamine |
| SMILES | CCC1=CC[C@H](N/C(C)=C\C(N)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H21F3N2/c1-3-10-4-6-11(7-5-10)18-9(2)8-12(17)13(14,15)16/h4,8,11-12,18H,3,5-7,17H2,1-2H3/b9-8-/t11-,12?/m0/s1 |
| InChIKey | XYKCVVTVYJJROG-PTDDZHHVSA-N |
| XLogP | 3.26 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|