C19H15ClN4 — CID 11898431
(1R,4R,4aS)-4-(3-chlorophenyl)-2-imino-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile (PubChem CID 11898431) has the molecular formula C19H15ClN4 and a molecular weight of 334.81 g/mol. Its IUPAC name is (1R,4R,4aS)-4-(3-chlorophenyl)-2-imino-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile.
| Compound Name | (1R,4R,4aS)-4-(3-chlorophenyl)-2-imino-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 11898431 |
| Molecular Formula | C19H15ClN4 |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (1R,4R,4aS)-4-(3-chlorophenyl)-2-imino-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile |
| SMILES | [H]/N=C1\[C@H](C#N)C2=CCCC[C@H]2[C@H](c2cccc(Cl)c2)C1(C#N)C#N |
| InChI | InChI=1S/C19H15ClN4/c20-13-5-3-4-12(8-13)17-15-7-2-1-6-14(15)16(9-21)18(24)19(17,10-22)11-23/h3-6,8,15-17,24H,1-2,7H2/b24-18+/t15-,16-,17+/m1/s1 |
| InChIKey | SKKLLSZMGNVJLK-VMCMMXQBSA-N |
| XLogP | 4.36 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|