C6H11FeNO7+3 — CID 118984355
azane;2-hydroxypropane-1,2,3-tricarboxylic acid;iron(3+) (PubChem CID 118984355) has the molecular formula C6H11FeNO7+3 and a molecular weight of 265.00 g/mol. Its IUPAC name is azane;2-hydroxypropane-1,2,3-tricarboxylic acid;iron(3+).
| Compound Name | azane;2-hydroxypropane-1,2,3-tricarboxylic acid;iron(3+) |
|---|---|
| PubChem CID | 118984355 |
| Molecular Formula | C6H11FeNO7+3 |
| Molecular Weight | 265.00 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | azane;2-hydroxypropane-1,2,3-tricarboxylic acid;iron(3+) |
| SMILES | N.O=C(O)CC(O)(CC(=O)O)C(=O)O.[Fe+3] |
| InChI | InChI=1S/C6H8O7.Fe.H3N/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;1H3/q;+3; |
| InChIKey | FRHBOQMZUOWXQL-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 167.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.00 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|