About 8-iodo-1,3-dimethyl-2-oxopurin-6-olate
8-iodo-1,3-dimethyl-2-oxopurin-6-olate (PubChem CID 118985551) has the molecular formula C7H6IN4O2-
and a molecular weight of 305.06 g/mol. Its IUPAC name is 8-iodo-1,3-dimethyl-2-oxopurin-6-olate.
Molecular Properties
| Compound Name | 8-iodo-1,3-dimethyl-2-oxopurin-6-olate |
| PubChem CID | 118985551 |
| Molecular Formula | C7H6IN4O2- |
| Molecular Weight | 305.06 g/mol |
| Exact Mass | 304.95 |
| IUPAC Name | 8-iodo-1,3-dimethyl-2-oxopurin-6-olate |
| SMILES | Cn1c2nc(I)nc-2c([O-])n(C)c1=O |
| InChI | InChI=1S/C7H7IN4O2/c1-11-4-3(9-6(8)10-4)5(13)12(2)7(11)14/h13H,1-2H3/p-1 |
| InChIKey | XDSLALMQEKLLLR-UHFFFAOYSA-M |
| XLogP | -0.70 |
| TPSA | 75.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.06 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 8-iodo-1,3-dimethyl-2-oxopurin-6-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-iodo-1,3-dimethyl-2-oxopurin-6-olate?
The IUPAC name of 8-iodo-1,3-dimethyl-2-oxopurin-6-olate (CID 118985551) is 8-iodo-1,3-dimethyl-2-oxopurin-6-olate.
What is the SMILES notation for 8-iodo-1,3-dimethyl-2-oxopurin-6-olate?
The canonical SMILES for 8-iodo-1,3-dimethyl-2-oxopurin-6-olate is Cn1c2nc(I)nc-2c([O-])n(C)c1=O.
What is the InChIKey of 8-iodo-1,3-dimethyl-2-oxopurin-6-olate?
The InChIKey is XDSLALMQEKLLLR-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H7IN4O2/c1-11-4-3(9-6(8)10-4)5(13)12(2)7(11)14/h13H,1-2H3/p-1.
What are the key properties of 8-iodo-1,3-dimethyl-2-oxopurin-6-olate?
8-iodo-1,3-dimethyl-2-oxopurin-6-olate has a molecular weight of 305.06 g/mol, XLogP of -0.70, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-iodo-1,3-dimethyl-2-oxopurin-6-olate is sourced from PubChem (CID 118985551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).