C19H16N2O5S3 — CID 118986285
N-[4-[5-[(Z)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]phenyl]sulfonylacetamide (PubChem CID 118986285) has the molecular formula C19H16N2O5S3 and a molecular weight of 448.55 g/mol. Its IUPAC name is N-[4-[5-[(Z)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]phenyl]sulfonylacetamide.
| Compound Name | N-[4-[5-[(Z)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]phenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 118986285 |
| Molecular Formula | C19H16N2O5S3 |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | N-[4-[5-[(Z)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]phenyl]sulfonylacetamide |
| SMILES | C=CCN1C(=O)/C(=C/c2ccc(-c3ccc(S(=O)(=O)NC(C)=O)cc3)o2)SC1=S |
| InChI | InChI=1S/C19H16N2O5S3/c1-3-10-21-18(23)17(28-19(21)27)11-14-6-9-16(26-14)13-4-7-15(8-5-13)29(24,25)20-12(2)22/h3-9,11H,1,10H2,2H3,(H,20,22)/b17-11- |
| InChIKey | QDCLBRMLONYIHR-BOPFTXTBSA-N |
| XLogP | 3.16 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|