C32H31F2N3O2 — CID 118986545
9-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]methyl]-5,11,11-trimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraene-2,3-dione (PubChem CID 118986545) has the molecular formula C32H31F2N3O2 and a molecular weight of 527.62 g/mol. Its IUPAC name is 9-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]methyl]-5,11,11-trimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraene-2,3-dione.
| Compound Name | 9-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]methyl]-5,11,11-trimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraene-2,3-dione |
|---|---|
| PubChem CID | 118986545 |
| Molecular Formula | C32H31F2N3O2 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | 9-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]methyl]-5,11,11-trimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraene-2,3-dione |
| SMILES | Cc1ccc2c3c1C(=O)C(=O)N3C(C)(C)C=C2CN1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C32H31F2N3O2/c1-20-4-13-26-23(18-32(2,3)37-29(26)27(20)30(38)31(37)39)19-35-14-16-36(17-15-35)28(21-5-9-24(33)10-6-21)22-7-11-25(34)12-8-22/h4-13,18,28H,14-17,19H2,1-3H3 |
| InChIKey | KGHOEOAKQQJGPL-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|