C19H21NO4 — CID 118986596
ethyl 6,8,8,9-tetramethyl-2-oxopyrano[3,2-g]quinoline-3-carboxylate (PubChem CID 118986596) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is ethyl 6,8,8,9-tetramethyl-2-oxopyrano[3,2-g]quinoline-3-carboxylate.
| Compound Name | ethyl 6,8,8,9-tetramethyl-2-oxopyrano[3,2-g]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 118986596 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | ethyl 6,8,8,9-tetramethyl-2-oxopyrano[3,2-g]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cc2cc3c(cc2oc1=O)N(C)C(C)(C)C=C3C |
| InChI | InChI=1S/C19H21NO4/c1-6-23-17(21)14-8-12-7-13-11(2)10-19(3,4)20(5)15(13)9-16(12)24-18(14)22/h7-10H,6H2,1-5H3 |
| InChIKey | WJUVINBJTNVWTK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|