About 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-[(E)-pyridin-4-ylmethylideneamino]benzamide
4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-[(E)-pyridin-4-ylmethylideneamino]benzamide (PubChem CID 118986838) has the molecular formula C22H19N5O
and a molecular weight of 369.43 g/mol. Its IUPAC name is 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-[(E)-pyridin-4-ylmethylideneamino]benzamide.
Molecular Properties
| Compound Name | 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-[(E)-pyridin-4-ylmethylideneamino]benzamide |
| PubChem CID | 118986838 |
| Molecular Formula | C22H19N5O |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-[(E)-pyridin-4-ylmethylideneamino]benzamide |
| SMILES | Cc1cc2nc(-c3ccc(C(=O)N/N=C/c4ccncc4)cc3)[nH]c2cc1C |
| InChI | InChI=1S/C22H19N5O/c1-14-11-19-20(12-15(14)2)26-21(25-19)17-3-5-18(6-4-17)22(28)27-24-13-16-7-9-23-10-8-16/h3-13H,1-2H3,(H,25,26)(H,27,28)/b24-13+ |
| InChIKey | BSLXEOMAKRKVFR-ZMOGYAJESA-N |
| XLogP | 4.01 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-[(E)-pyridin-4-ylmethylideneamino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-[(E)-pyridin-4-ylmethylideneamino]benzamide?
The IUPAC name of 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-[(E)-pyridin-4-ylmethylideneamino]benzamide (CID 118986838) is 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-[(E)-pyridin-4-ylmethylideneamino]benzamide.
What is the SMILES notation for 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-[(E)-pyridin-4-ylmethylideneamino]benzamide?
The canonical SMILES for 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-[(E)-pyridin-4-ylmethylideneamino]benzamide is Cc1cc2nc(-c3ccc(C(=O)N/N=C/c4ccncc4)cc3)[nH]c2cc1C.
What is the InChIKey of 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-[(E)-pyridin-4-ylmethylideneamino]benzamide?
The InChIKey is BSLXEOMAKRKVFR-ZMOGYAJESA-N. The full InChI is InChI=1S/C22H19N5O/c1-14-11-19-20(12-15(14)2)26-21(25-19)17-3-5-18(6-4-17)22(28)27-24-13-16-7-9-23-10-8-16/h3-13H,1-2H3,(H,25,26)(H,27,28)/b24-13+.
What are the key properties of 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-[(E)-pyridin-4-ylmethylideneamino]benzamide?
4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-[(E)-pyridin-4-ylmethylideneamino]benzamide has a molecular weight of 369.43 g/mol, XLogP of 4.01, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-[(E)-pyridin-4-ylmethylideneamino]benzamide is sourced from PubChem (CID 118986838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).