About [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-phenylcarbamate
[1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-phenylcarbamate (PubChem CID 118986854) has the molecular formula C24H23ClN2O2
and a molecular weight of 406.91 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-phenylcarbamate.
Molecular Properties
| Compound Name | [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-phenylcarbamate |
| PubChem CID | 118986854 |
| Molecular Formula | C24H23ClN2O2 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)OC(CN1CCCc2ccccc21)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H23ClN2O2/c25-20-14-12-19(13-15-20)23(29-24(28)26-21-9-2-1-3-10-21)17-27-16-6-8-18-7-4-5-11-22(18)27/h1-5,7,9-15,23H,6,8,16-17H2,(H,26,28) |
| InChIKey | AIRWOKHKIVSFJM-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-phenylcarbamate?
The IUPAC name of [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-phenylcarbamate (CID 118986854) is [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-phenylcarbamate.
What is the SMILES notation for [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-phenylcarbamate?
The canonical SMILES for [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-phenylcarbamate is O=C(Nc1ccccc1)OC(CN1CCCc2ccccc21)c1ccc(Cl)cc1.
What is the InChIKey of [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-phenylcarbamate?
The InChIKey is AIRWOKHKIVSFJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23ClN2O2/c25-20-14-12-19(13-15-20)23(29-24(28)26-21-9-2-1-3-10-21)17-27-16-6-8-18-7-4-5-11-22(18)27/h1-5,7,9-15,23H,6,8,16-17H2,(H,26,28).
What are the key properties of [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-phenylcarbamate?
[1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-phenylcarbamate has a molecular weight of 406.91 g/mol, XLogP of 6.08, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-phenylcarbamate is sourced from PubChem (CID 118986854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).