About [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-(3-fluorophenyl)carbamate
[1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-(3-fluorophenyl)carbamate (PubChem CID 118986859) has the molecular formula C24H22ClFN2O2
and a molecular weight of 424.90 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-(3-fluorophenyl)carbamate.
Molecular Properties
| Compound Name | [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-(3-fluorophenyl)carbamate |
| PubChem CID | 118986859 |
| Molecular Formula | C24H22ClFN2O2 |
| Molecular Weight | 424.90 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-(3-fluorophenyl)carbamate |
| SMILES | O=C(Nc1cccc(F)c1)OC(CN1CCCc2ccccc21)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H22ClFN2O2/c25-19-12-10-18(11-13-19)23(30-24(29)27-21-8-3-7-20(26)15-21)16-28-14-4-6-17-5-1-2-9-22(17)28/h1-3,5,7-13,15,23H,4,6,14,16H2,(H,27,29) |
| InChIKey | HSGPNKNCRRWLNJ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.90 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-(3-fluorophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-(3-fluorophenyl)carbamate?
The IUPAC name of [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-(3-fluorophenyl)carbamate (CID 118986859) is [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-(3-fluorophenyl)carbamate.
What is the SMILES notation for [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-(3-fluorophenyl)carbamate?
The canonical SMILES for [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-(3-fluorophenyl)carbamate is O=C(Nc1cccc(F)c1)OC(CN1CCCc2ccccc21)c1ccc(Cl)cc1.
What is the InChIKey of [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-(3-fluorophenyl)carbamate?
The InChIKey is HSGPNKNCRRWLNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22ClFN2O2/c25-19-12-10-18(11-13-19)23(30-24(29)27-21-8-3-7-20(26)15-21)16-28-14-4-6-17-5-1-2-9-22(17)28/h1-3,5,7-13,15,23H,4,6,14,16H2,(H,27,29).
What are the key properties of [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-(3-fluorophenyl)carbamate?
[1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-(3-fluorophenyl)carbamate has a molecular weight of 424.90 g/mol, XLogP of 6.22, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethyl] N-(3-fluorophenyl)carbamate is sourced from PubChem (CID 118986859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).