C11H21NO3 — CID 118986928
(2R,3R,4R)-2-(hydroxymethyl)-1-(3-methylbut-2-enyl)piperidine-3,4-diol (PubChem CID 118986928) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is (2R,3R,4R)-2-(hydroxymethyl)-1-(3-methylbut-2-enyl)piperidine-3,4-diol.
| Compound Name | (2R,3R,4R)-2-(hydroxymethyl)-1-(3-methylbut-2-enyl)piperidine-3,4-diol |
|---|---|
| PubChem CID | 118986928 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | (2R,3R,4R)-2-(hydroxymethyl)-1-(3-methylbut-2-enyl)piperidine-3,4-diol |
| SMILES | CC(C)=CCN1CC[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C11H21NO3/c1-8(2)3-5-12-6-4-10(14)11(15)9(12)7-13/h3,9-11,13-15H,4-7H2,1-2H3/t9-,10-,11-/m1/s1 |
| InChIKey | IKIFNFUKNFLXAP-GMTAPVOTSA-N |
| XLogP | -0.26 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|