C16H26N5O7- — CID 118987176
N-[(1R,2S,5S)-2-azido-5-(dimethylcarbamoyl)cyclohexyl]-N-tert-butylcarbamate;oxalic acid (PubChem CID 118987176) has the molecular formula C16H26N5O7- and a molecular weight of 400.41 g/mol. Its IUPAC name is N-[(1R,2S,5S)-2-azido-5-(dimethylcarbamoyl)cyclohexyl]-N-tert-butylcarbamate;oxalic acid.
| Compound Name | N-[(1R,2S,5S)-2-azido-5-(dimethylcarbamoyl)cyclohexyl]-N-tert-butylcarbamate;oxalic acid |
|---|---|
| PubChem CID | 118987176 |
| Molecular Formula | C16H26N5O7- |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-[(1R,2S,5S)-2-azido-5-(dimethylcarbamoyl)cyclohexyl]-N-tert-butylcarbamate;oxalic acid |
| SMILES | CN(C)C(=O)[C@H]1CC[C@H](N=[N+]=[N-])[C@H](N(C(=O)[O-])C(C)(C)C)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H25N5O3.C2H2O4/c1-14(2,3)19(13(21)22)11-8-9(12(20)18(4)5)6-7-10(11)16-17-15;3-1(4)2(5)6/h9-11H,6-8H2,1-5H3,(H,21,22);(H,3,4)(H,5,6)/p-1/t9-,10-,11+;/m0./s1 |
| InChIKey | BPGKFRRCMDGZGF-PBDVDRNWSA-M |
| XLogP | 0.52 |
| TPSA | 187.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|