About (4S)-2,4-dihydroxy-4-(hydroxymethyl)-6-oxocyclohexen-1-olate
(4S)-2,4-dihydroxy-4-(hydroxymethyl)-6-oxocyclohexen-1-olate (PubChem CID 118987343) has the molecular formula C7H9O5-
and a molecular weight of 173.14 g/mol. Its IUPAC name is (4S)-2,4-dihydroxy-4-(hydroxymethyl)-6-oxocyclohexen-1-olate.
Molecular Properties
| Compound Name | (4S)-2,4-dihydroxy-4-(hydroxymethyl)-6-oxocyclohexen-1-olate |
| PubChem CID | 118987343 |
| Molecular Formula | C7H9O5- |
| Molecular Weight | 173.14 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | (4S)-2,4-dihydroxy-4-(hydroxymethyl)-6-oxocyclohexen-1-olate |
| SMILES | O=C1C[C@](O)(CO)CC(O)=C1[O-] |
| InChI | InChI=1S/C7H10O5/c8-3-7(12)1-4(9)6(11)5(10)2-7/h8-9,11-12H,1-3H2/p-1/t7-/m0/s1 |
| InChIKey | OWHGXOODGNBQRG-ZETCQYMHSA-M |
| XLogP | -1.80 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.14 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4S)-2,4-dihydroxy-4-(hydroxymethyl)-6-oxocyclohexen-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2,4-dihydroxy-4-(hydroxymethyl)-6-oxocyclohexen-1-olate?
The IUPAC name of (4S)-2,4-dihydroxy-4-(hydroxymethyl)-6-oxocyclohexen-1-olate (CID 118987343) is (4S)-2,4-dihydroxy-4-(hydroxymethyl)-6-oxocyclohexen-1-olate.
What is the SMILES notation for (4S)-2,4-dihydroxy-4-(hydroxymethyl)-6-oxocyclohexen-1-olate?
The canonical SMILES for (4S)-2,4-dihydroxy-4-(hydroxymethyl)-6-oxocyclohexen-1-olate is O=C1C[C@](O)(CO)CC(O)=C1[O-].
What is the InChIKey of (4S)-2,4-dihydroxy-4-(hydroxymethyl)-6-oxocyclohexen-1-olate?
The InChIKey is OWHGXOODGNBQRG-ZETCQYMHSA-M. The full InChI is InChI=1S/C7H10O5/c8-3-7(12)1-4(9)6(11)5(10)2-7/h8-9,11-12H,1-3H2/p-1/t7-/m0/s1.
What are the key properties of (4S)-2,4-dihydroxy-4-(hydroxymethyl)-6-oxocyclohexen-1-olate?
(4S)-2,4-dihydroxy-4-(hydroxymethyl)-6-oxocyclohexen-1-olate has a molecular weight of 173.14 g/mol, XLogP of -1.80, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2,4-dihydroxy-4-(hydroxymethyl)-6-oxocyclohexen-1-olate is sourced from PubChem (CID 118987343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).