About (5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one
(5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one (PubChem CID 118987344) has the molecular formula C7H10O5
and a molecular weight of 174.15 g/mol. Its IUPAC name is (5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one.
Molecular Properties
| Compound Name | (5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one |
| PubChem CID | 118987344 |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | (5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one |
| SMILES | O=C1C[C@](O)(CO)CC(O)=C1O |
| InChI | InChI=1S/C7H10O5/c8-3-7(12)1-4(9)6(11)5(10)2-7/h8-9,11-12H,1-3H2/t7-/m0/s1 |
| InChIKey | OWHGXOODGNBQRG-ZETCQYMHSA-N |
| XLogP | -0.60 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one?
The IUPAC name of (5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one (CID 118987344) is (5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one.
What is the SMILES notation for (5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one?
The canonical SMILES for (5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one is O=C1C[C@](O)(CO)CC(O)=C1O.
What is the InChIKey of (5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one?
The InChIKey is OWHGXOODGNBQRG-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H10O5/c8-3-7(12)1-4(9)6(11)5(10)2-7/h8-9,11-12H,1-3H2/t7-/m0/s1.
What are the key properties of (5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one?
(5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one has a molecular weight of 174.15 g/mol, XLogP of -0.60, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one is sourced from PubChem (CID 118987344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).