About 3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-(3-fluorophenyl)pyridin-2-one
3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-(3-fluorophenyl)pyridin-2-one (PubChem CID 118987430) has the molecular formula C28H21FN2O4
and a molecular weight of 468.48 g/mol. Its IUPAC name is 3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-(3-fluorophenyl)pyridin-2-one.
Molecular Properties
| Compound Name | 3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-(3-fluorophenyl)pyridin-2-one |
| PubChem CID | 118987430 |
| Molecular Formula | C28H21FN2O4 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-(3-fluorophenyl)pyridin-2-one |
| SMILES | COc1cc2nccc(Oc3ccc(-c4cccn(-c5cccc(F)c5)c4=O)cc3)c2cc1OC |
| InChI | InChI=1S/C28H21FN2O4/c1-33-26-16-23-24(17-27(26)34-2)30-13-12-25(23)35-21-10-8-18(9-11-21)22-7-4-14-31(28(22)32)20-6-3-5-19(29)15-20/h3-17H,1-2H3 |
| InChIKey | JGFNXSOZXBHIHB-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-(3-fluorophenyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-(3-fluorophenyl)pyridin-2-one?
The IUPAC name of 3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-(3-fluorophenyl)pyridin-2-one (CID 118987430) is 3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-(3-fluorophenyl)pyridin-2-one.
What is the SMILES notation for 3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-(3-fluorophenyl)pyridin-2-one?
The canonical SMILES for 3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-(3-fluorophenyl)pyridin-2-one is COc1cc2nccc(Oc3ccc(-c4cccn(-c5cccc(F)c5)c4=O)cc3)c2cc1OC.
What is the InChIKey of 3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-(3-fluorophenyl)pyridin-2-one?
The InChIKey is JGFNXSOZXBHIHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H21FN2O4/c1-33-26-16-23-24(17-27(26)34-2)30-13-12-25(23)35-21-10-8-18(9-11-21)22-7-4-14-31(28(22)32)20-6-3-5-19(29)15-20/h3-17H,1-2H3.
What are the key properties of 3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-(3-fluorophenyl)pyridin-2-one?
3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-(3-fluorophenyl)pyridin-2-one has a molecular weight of 468.48 g/mol, XLogP of 6.00, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-(3-fluorophenyl)pyridin-2-one is sourced from PubChem (CID 118987430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).