About N'-methyl-N'-[[4-[3-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]methyl]ethane-1,2-diamine
N'-methyl-N'-[[4-[3-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]methyl]ethane-1,2-diamine (PubChem CID 118987452) has the molecular formula C15H18F3N3
and a molecular weight of 297.32 g/mol. Its IUPAC name is N'-methyl-N'-[[4-[3-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]methyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-methyl-N'-[[4-[3-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]methyl]ethane-1,2-diamine |
| PubChem CID | 118987452 |
| Molecular Formula | C15H18F3N3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N'-methyl-N'-[[4-[3-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]methyl]ethane-1,2-diamine |
| SMILES | CN(CCN)Cc1c[nH]cc1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H18F3N3/c1-21(6-5-19)10-12-8-20-9-14(12)11-3-2-4-13(7-11)15(16,17)18/h2-4,7-9,20H,5-6,10,19H2,1H3 |
| InChIKey | VZDPLMKEFMWBMM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-methyl-N'-[[4-[3-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]methyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N'-[[4-[3-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]methyl]ethane-1,2-diamine?
The IUPAC name of N'-methyl-N'-[[4-[3-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]methyl]ethane-1,2-diamine (CID 118987452) is N'-methyl-N'-[[4-[3-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]methyl]ethane-1,2-diamine.
What is the SMILES notation for N'-methyl-N'-[[4-[3-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]methyl]ethane-1,2-diamine?
The canonical SMILES for N'-methyl-N'-[[4-[3-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]methyl]ethane-1,2-diamine is CN(CCN)Cc1c[nH]cc1-c1cccc(C(F)(F)F)c1.
What is the InChIKey of N'-methyl-N'-[[4-[3-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]methyl]ethane-1,2-diamine?
The InChIKey is VZDPLMKEFMWBMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F3N3/c1-21(6-5-19)10-12-8-20-9-14(12)11-3-2-4-13(7-11)15(16,17)18/h2-4,7-9,20H,5-6,10,19H2,1H3.
What are the key properties of N'-methyl-N'-[[4-[3-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]methyl]ethane-1,2-diamine?
N'-methyl-N'-[[4-[3-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]methyl]ethane-1,2-diamine has a molecular weight of 297.32 g/mol, XLogP of 3.09, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N'-[[4-[3-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]methyl]ethane-1,2-diamine is sourced from PubChem (CID 118987452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).