C17H25FN6O2 — CID 118987530
2-[4-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]butyl]-4-methyl-1,2,4-triazinane-3,5-dione (PubChem CID 118987530) has the molecular formula C17H25FN6O2 and a molecular weight of 364.43 g/mol. Its IUPAC name is 2-[4-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]butyl]-4-methyl-1,2,4-triazinane-3,5-dione.
| Compound Name | 2-[4-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]butyl]-4-methyl-1,2,4-triazinane-3,5-dione |
|---|---|
| PubChem CID | 118987530 |
| Molecular Formula | C17H25FN6O2 |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 2-[4-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]butyl]-4-methyl-1,2,4-triazinane-3,5-dione |
| SMILES | CN1C(=O)CNN(CCCCN2CCN(c3ccc(F)cn3)CC2)C1=O |
| InChI | InChI=1S/C17H25FN6O2/c1-21-16(25)13-20-24(17(21)26)7-3-2-6-22-8-10-23(11-9-22)15-5-4-14(18)12-19-15/h4-5,12,20H,2-3,6-11,13H2,1H3 |
| InChIKey | PWZXAXCVKJGXNF-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 72.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|