C17H23N3 — CID 118988018
14-azaheptacyclo[8.6.1.02,5.03,11.04,9.06,17.012,16]heptadecane-14-carboximidamide (PubChem CID 118988018) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is 14-azaheptacyclo[8.6.1.02,5.03,11.04,9.06,17.012,16]heptadecane-14-carboximidamide.
| Compound Name | 14-azaheptacyclo[8.6.1.02,5.03,11.04,9.06,17.012,16]heptadecane-14-carboximidamide |
|---|---|
| PubChem CID | 118988018 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 14-azaheptacyclo[8.6.1.02,5.03,11.04,9.06,17.012,16]heptadecane-14-carboximidamide |
| SMILES | [H]/N=C(\N)N1CC2C(C1)C1C3C4CCC5C3C2C2C5C4C12 |
| InChI | InChI=1S/C17H23N3/c18-17(19)20-3-7-8(4-20)14-10-6-2-1-5-9(10)13(7)15-11(5)12(6)16(14)15/h5-16H,1-4H2,(H3,18,19) |
| InChIKey | XDBODLGBYWMBCF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|