C31H42N6O2 — CID 118988078
N-[(R)-cyclopentyl(pyrimidin-2-yl)methyl]-3-[4-[(1S,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide (PubChem CID 118988078) has the molecular formula C31H42N6O2 and a molecular weight of 530.72 g/mol. Its IUPAC name is N-[(R)-cyclopentyl(pyrimidin-2-yl)methyl]-3-[4-[(1S,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide.
| Compound Name | N-[(R)-cyclopentyl(pyrimidin-2-yl)methyl]-3-[4-[(1S,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 118988078 |
| Molecular Formula | C31H42N6O2 |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.34 |
| IUPAC Name | N-[(R)-cyclopentyl(pyrimidin-2-yl)methyl]-3-[4-[(1S,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
| SMILES | O=C(N[C@@H](c1ncccn1)C1CCCC1)C1CCC2NNC(c3ccc(N4[C@H]5CC[C@H]4CC(O)C5)cc3)C2C1 |
| InChI | InChI=1S/C31H42N6O2/c38-25-17-23-11-12-24(18-25)37(23)22-9-6-20(7-10-22)28-26-16-21(8-13-27(26)35-36-28)31(39)34-29(19-4-1-2-5-19)30-32-14-3-15-33-30/h3,6-7,9-10,14-15,19,21,23-29,35-36,38H,1-2,4-5,8,11-13,16-18H2,(H,34,39)/t21?,23-,24-,26?,27?,28?,29+/m0/s1 |
| InChIKey | TUNQPTJDAXLRAT-ZOABPSBRSA-N |
| XLogP | 3.95 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |