C12H9F5O — CID 118988098
(3R)-1,1,1,2,2-pentafluoro-3-phenylhexa-4,5-dien-3-ol (PubChem CID 118988098) has the molecular formula C12H9F5O and a molecular weight of 264.19 g/mol. Its IUPAC name is (3R)-1,1,1,2,2-pentafluoro-3-phenylhexa-4,5-dien-3-ol.
| Compound Name | (3R)-1,1,1,2,2-pentafluoro-3-phenylhexa-4,5-dien-3-ol |
|---|---|
| PubChem CID | 118988098 |
| Molecular Formula | C12H9F5O |
| Molecular Weight | 264.19 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | (3R)-1,1,1,2,2-pentafluoro-3-phenylhexa-4,5-dien-3-ol |
| SMILES | C=C=C[C@@](O)(c1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H9F5O/c1-2-8-10(18,9-6-4-3-5-7-9)11(13,14)12(15,16)17/h3-8,18H,1H2/t10-/m1/s1 |
| InChIKey | ZNHJVWKGMIFWOT-SNVBAGLBSA-N |
| XLogP | 3.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.19 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|