C11H17F3O — CID 118988123
(2R)-2-cyclohexyl-1,1,1-trifluoropent-4-en-2-ol (PubChem CID 118988123) has the molecular formula C11H17F3O and a molecular weight of 222.25 g/mol. Its IUPAC name is (2R)-2-cyclohexyl-1,1,1-trifluoropent-4-en-2-ol.
| Compound Name | (2R)-2-cyclohexyl-1,1,1-trifluoropent-4-en-2-ol |
|---|---|
| PubChem CID | 118988123 |
| Molecular Formula | C11H17F3O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | (2R)-2-cyclohexyl-1,1,1-trifluoropent-4-en-2-ol |
| SMILES | C=CC[C@@](O)(C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C11H17F3O/c1-2-8-10(15,11(12,13)14)9-6-4-3-5-7-9/h2,9,15H,1,3-8H2/t10-/m1/s1 |
| InChIKey | KKOZRZDNQNXTBV-SNVBAGLBSA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|