About (2R)-2-cyclohexyl-1,1,1-trifluoropent-4-en-2-ol
(2R)-2-cyclohexyl-1,1,1-trifluoropent-4-en-2-ol (PubChem CID 118988123) has the molecular formula C11H17F3O
and a molecular weight of 222.25 g/mol. Its IUPAC name is (2R)-2-cyclohexyl-1,1,1-trifluoropent-4-en-2-ol.
Molecular Properties
| Compound Name | (2R)-2-cyclohexyl-1,1,1-trifluoropent-4-en-2-ol |
| PubChem CID | 118988123 |
| Molecular Formula | C11H17F3O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | (2R)-2-cyclohexyl-1,1,1-trifluoropent-4-en-2-ol |
| SMILES | C=CC[C@@](O)(C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C11H17F3O/c1-2-8-10(15,11(12,13)14)9-6-4-3-5-7-9/h2,9,15H,1,3-8H2/t10-/m1/s1 |
| InChIKey | KKOZRZDNQNXTBV-SNVBAGLBSA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-cyclohexyl-1,1,1-trifluoropent-4-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-cyclohexyl-1,1,1-trifluoropent-4-en-2-ol?
The IUPAC name of (2R)-2-cyclohexyl-1,1,1-trifluoropent-4-en-2-ol (CID 118988123) is (2R)-2-cyclohexyl-1,1,1-trifluoropent-4-en-2-ol.
What is the SMILES notation for (2R)-2-cyclohexyl-1,1,1-trifluoropent-4-en-2-ol?
The canonical SMILES for (2R)-2-cyclohexyl-1,1,1-trifluoropent-4-en-2-ol is C=CC[C@@](O)(C1CCCCC1)C(F)(F)F.
What is the InChIKey of (2R)-2-cyclohexyl-1,1,1-trifluoropent-4-en-2-ol?
The InChIKey is KKOZRZDNQNXTBV-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H17F3O/c1-2-8-10(15,11(12,13)14)9-6-4-3-5-7-9/h2,9,15H,1,3-8H2/t10-/m1/s1.
What are the key properties of (2R)-2-cyclohexyl-1,1,1-trifluoropent-4-en-2-ol?
(2R)-2-cyclohexyl-1,1,1-trifluoropent-4-en-2-ol has a molecular weight of 222.25 g/mol, XLogP of 3.44, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-cyclohexyl-1,1,1-trifluoropent-4-en-2-ol is sourced from PubChem (CID 118988123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).