C13H14F3NO — CID 118988127
(2R)-2-[4-(dimethylamino)phenyl]-1,1,1-trifluoropenta-3,4-dien-2-ol (PubChem CID 118988127) has the molecular formula C13H14F3NO and a molecular weight of 257.25 g/mol. Its IUPAC name is (2R)-2-[4-(dimethylamino)phenyl]-1,1,1-trifluoropenta-3,4-dien-2-ol.
| Compound Name | (2R)-2-[4-(dimethylamino)phenyl]-1,1,1-trifluoropenta-3,4-dien-2-ol |
|---|---|
| PubChem CID | 118988127 |
| Molecular Formula | C13H14F3NO |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | (2R)-2-[4-(dimethylamino)phenyl]-1,1,1-trifluoropenta-3,4-dien-2-ol |
| SMILES | C=C=C[C@@](O)(c1ccc(N(C)C)cc1)C(F)(F)F |
| InChI | InChI=1S/C13H14F3NO/c1-4-9-12(18,13(14,15)16)10-5-7-11(8-6-10)17(2)3/h5-9,18H,1H2,2-3H3/t12-/m1/s1 |
| InChIKey | MAFQCWCCZDGDLW-GFCCVEGCSA-N |
| XLogP | 2.84 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|