About (2S)-1,1,1-trifluoro-2-thiophen-2-ylpent-4-en-2-ol
(2S)-1,1,1-trifluoro-2-thiophen-2-ylpent-4-en-2-ol (PubChem CID 118988132) has the molecular formula C9H9F3OS
and a molecular weight of 222.23 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-2-thiophen-2-ylpent-4-en-2-ol.
Molecular Properties
| Compound Name | (2S)-1,1,1-trifluoro-2-thiophen-2-ylpent-4-en-2-ol |
| PubChem CID | 118988132 |
| Molecular Formula | C9H9F3OS |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | (2S)-1,1,1-trifluoro-2-thiophen-2-ylpent-4-en-2-ol |
| SMILES | C=CC[C@@](O)(c1cccs1)C(F)(F)F |
| InChI | InChI=1S/C9H9F3OS/c1-2-5-8(13,9(10,11)12)7-4-3-6-14-7/h2-4,6,13H,1,5H2/t8-/m1/s1 |
| InChIKey | VGNSDIMVRGPAIZ-MRVPVSSYSA-N |
| XLogP | 3.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1,1,1-trifluoro-2-thiophen-2-ylpent-4-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,1,1-trifluoro-2-thiophen-2-ylpent-4-en-2-ol?
The IUPAC name of (2S)-1,1,1-trifluoro-2-thiophen-2-ylpent-4-en-2-ol (CID 118988132) is (2S)-1,1,1-trifluoro-2-thiophen-2-ylpent-4-en-2-ol.
What is the SMILES notation for (2S)-1,1,1-trifluoro-2-thiophen-2-ylpent-4-en-2-ol?
The canonical SMILES for (2S)-1,1,1-trifluoro-2-thiophen-2-ylpent-4-en-2-ol is C=CC[C@@](O)(c1cccs1)C(F)(F)F.
What is the InChIKey of (2S)-1,1,1-trifluoro-2-thiophen-2-ylpent-4-en-2-ol?
The InChIKey is VGNSDIMVRGPAIZ-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H9F3OS/c1-2-5-8(13,9(10,11)12)7-4-3-6-14-7/h2-4,6,13H,1,5H2/t8-/m1/s1.
What are the key properties of (2S)-1,1,1-trifluoro-2-thiophen-2-ylpent-4-en-2-ol?
(2S)-1,1,1-trifluoro-2-thiophen-2-ylpent-4-en-2-ol has a molecular weight of 222.23 g/mol, XLogP of 3.07, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,1,1-trifluoro-2-thiophen-2-ylpent-4-en-2-ol is sourced from PubChem (CID 118988132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).