C9H7F3OS — CID 118988138
(2S)-1,1,1-trifluoro-2-thiophen-2-ylpenta-3,4-dien-2-ol (PubChem CID 118988138) has the molecular formula C9H7F3OS and a molecular weight of 220.22 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-2-thiophen-2-ylpenta-3,4-dien-2-ol.
| Compound Name | (2S)-1,1,1-trifluoro-2-thiophen-2-ylpenta-3,4-dien-2-ol |
|---|---|
| PubChem CID | 118988138 |
| Molecular Formula | C9H7F3OS |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | (2S)-1,1,1-trifluoro-2-thiophen-2-ylpenta-3,4-dien-2-ol |
| SMILES | C=C=C[C@@](O)(c1cccs1)C(F)(F)F |
| InChI | InChI=1S/C9H7F3OS/c1-2-5-8(13,9(10,11)12)7-4-3-6-14-7/h3-6,13H,1H2/t8-/m1/s1 |
| InChIKey | VDVBPJRWXUAQKY-MRVPVSSYSA-N |
| XLogP | 2.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |