About pyrido[3,4-g]quinazoline-2,10-diamine
pyrido[3,4-g]quinazoline-2,10-diamine (PubChem CID 118988439) has the molecular formula C11H9N5
and a molecular weight of 211.23 g/mol. Its IUPAC name is pyrido[3,4-g]quinazoline-2,10-diamine.
Molecular Properties
| Compound Name | pyrido[3,4-g]quinazoline-2,10-diamine |
| PubChem CID | 118988439 |
| Molecular Formula | C11H9N5 |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | pyrido[3,4-g]quinazoline-2,10-diamine |
| SMILES | Nc1ncc2cc3cnccc3c(N)c2n1 |
| InChI | InChI=1S/C11H9N5/c12-9-8-1-2-14-4-6(8)3-7-5-15-11(13)16-10(7)9/h1-5H,12H2,(H2,13,15,16) |
| InChIKey | PQAQQDCVZZTPPJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze pyrido[3,4-g]quinazoline-2,10-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrido[3,4-g]quinazoline-2,10-diamine?
The IUPAC name of pyrido[3,4-g]quinazoline-2,10-diamine (CID 118988439) is pyrido[3,4-g]quinazoline-2,10-diamine.
What is the SMILES notation for pyrido[3,4-g]quinazoline-2,10-diamine?
The canonical SMILES for pyrido[3,4-g]quinazoline-2,10-diamine is Nc1ncc2cc3cnccc3c(N)c2n1.
What is the InChIKey of pyrido[3,4-g]quinazoline-2,10-diamine?
The InChIKey is PQAQQDCVZZTPPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N5/c12-9-8-1-2-14-4-6(8)3-7-5-15-11(13)16-10(7)9/h1-5H,12H2,(H2,13,15,16).
What are the key properties of pyrido[3,4-g]quinazoline-2,10-diamine?
pyrido[3,4-g]quinazoline-2,10-diamine has a molecular weight of 211.23 g/mol, XLogP of 1.34, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyrido[3,4-g]quinazoline-2,10-diamine is sourced from PubChem (CID 118988439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).