About pyrido[3,4-g]quinazolin-2-amine
pyrido[3,4-g]quinazolin-2-amine (PubChem CID 118988440) has the molecular formula C11H8N4
and a molecular weight of 196.21 g/mol. Its IUPAC name is pyrido[3,4-g]quinazolin-2-amine.
Molecular Properties
| Compound Name | pyrido[3,4-g]quinazolin-2-amine |
| PubChem CID | 118988440 |
| Molecular Formula | C11H8N4 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | pyrido[3,4-g]quinazolin-2-amine |
| SMILES | Nc1ncc2cc3cnccc3cc2n1 |
| InChI | InChI=1S/C11H8N4/c12-11-14-6-9-3-8-5-13-2-1-7(8)4-10(9)15-11/h1-6H,(H2,12,14,15) |
| InChIKey | HTMYPIWEXZOFDM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze pyrido[3,4-g]quinazolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrido[3,4-g]quinazolin-2-amine?
The IUPAC name of pyrido[3,4-g]quinazolin-2-amine (CID 118988440) is pyrido[3,4-g]quinazolin-2-amine.
What is the SMILES notation for pyrido[3,4-g]quinazolin-2-amine?
The canonical SMILES for pyrido[3,4-g]quinazolin-2-amine is Nc1ncc2cc3cnccc3cc2n1.
What is the InChIKey of pyrido[3,4-g]quinazolin-2-amine?
The InChIKey is HTMYPIWEXZOFDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4/c12-11-14-6-9-3-8-5-13-2-1-7(8)4-10(9)15-11/h1-6H,(H2,12,14,15).
What are the key properties of pyrido[3,4-g]quinazolin-2-amine?
pyrido[3,4-g]quinazolin-2-amine has a molecular weight of 196.21 g/mol, XLogP of 1.76, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrido[3,4-g]quinazolin-2-amine is sourced from PubChem (CID 118988440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).