C25H33Cl2N7O2 — CID 118988504
6-[5-[4-(3,4-dichlorophenyl)piperazin-1-yl]pentyl]-2,4,7-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione (PubChem CID 118988504) has the molecular formula C25H33Cl2N7O2 and a molecular weight of 534.49 g/mol. Its IUPAC name is 6-[5-[4-(3,4-dichlorophenyl)piperazin-1-yl]pentyl]-2,4,7-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-[5-[4-(3,4-dichlorophenyl)piperazin-1-yl]pentyl]-2,4,7-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 118988504 |
| Molecular Formula | C25H33Cl2N7O2 |
| Molecular Weight | 534.49 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | 6-[5-[4-(3,4-dichlorophenyl)piperazin-1-yl]pentyl]-2,4,7-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione |
| SMILES | CC1=CN2C(=NC3C2C(=O)N(C)C(=O)N3C)N1CCCCCN1CCN(c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C25H33Cl2N7O2/c1-17-16-34-21-22(29(2)25(36)30(3)23(21)35)28-24(34)33(17)10-6-4-5-9-31-11-13-32(14-12-31)18-7-8-19(26)20(27)15-18/h7-8,15-16,21-22H,4-6,9-14H2,1-3H3 |
| InChIKey | JRVDNEGCZRTGKE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 65.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|