C14H18ClN3O — CID 118988631
(6R)-6-(trideuteriomethylamino)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide;hydrochloride (PubChem CID 118988631) has the molecular formula C14H18ClN3O and a molecular weight of 282.79 g/mol. Its IUPAC name is (6R)-6-(trideuteriomethylamino)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide;hydrochloride.
| Compound Name | (6R)-6-(trideuteriomethylamino)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 118988631 |
| Molecular Formula | C14H18ClN3O |
| Molecular Weight | 282.79 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (6R)-6-(trideuteriomethylamino)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide;hydrochloride |
| SMILES | Cl.[2H]C([2H])([2H])N[C@@H]1CCc2[nH]c3ccc(C(N)=O)cc3c2C1 |
| InChI | InChI=1S/C14H17N3O.ClH/c1-16-9-3-5-13-11(7-9)10-6-8(14(15)18)2-4-12(10)17-13;/h2,4,6,9,16-17H,3,5,7H2,1H3,(H2,15,18);1H/t9-;/m1./s1/i1D3; |
| InChIKey | VJFWRVTVFIHPAR-AXHFJGNISA-N |
| XLogP | 1.77 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.79 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|