About 7-[[1-[(2,6-difluorophenyl)methyl]pyridin-1-ium-4-yl]methoxy]-6-methoxychromen-2-one
7-[[1-[(2,6-difluorophenyl)methyl]pyridin-1-ium-4-yl]methoxy]-6-methoxychromen-2-one (PubChem CID 118988688) has the molecular formula C23H18F2NO4+
and a molecular weight of 410.40 g/mol. Its IUPAC name is 7-[[1-[(2,6-difluorophenyl)methyl]pyridin-1-ium-4-yl]methoxy]-6-methoxychromen-2-one.
Molecular Properties
| Compound Name | 7-[[1-[(2,6-difluorophenyl)methyl]pyridin-1-ium-4-yl]methoxy]-6-methoxychromen-2-one |
| PubChem CID | 118988688 |
| Molecular Formula | C23H18F2NO4+ |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 7-[[1-[(2,6-difluorophenyl)methyl]pyridin-1-ium-4-yl]methoxy]-6-methoxychromen-2-one |
| SMILES | COc1cc2ccc(=O)oc2cc1OCc1cc[n+](Cc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C23H18F2NO4/c1-28-21-11-16-5-6-23(27)30-20(16)12-22(21)29-14-15-7-9-26(10-8-15)13-17-18(24)3-2-4-19(17)25/h2-12H,13-14H2,1H3/q+1 |
| InChIKey | CGPMITNBBOGYGY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 52.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 7-[[1-[(2,6-difluorophenyl)methyl]pyridin-1-ium-4-yl]methoxy]-6-methoxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[[1-[(2,6-difluorophenyl)methyl]pyridin-1-ium-4-yl]methoxy]-6-methoxychromen-2-one?
The IUPAC name of 7-[[1-[(2,6-difluorophenyl)methyl]pyridin-1-ium-4-yl]methoxy]-6-methoxychromen-2-one (CID 118988688) is 7-[[1-[(2,6-difluorophenyl)methyl]pyridin-1-ium-4-yl]methoxy]-6-methoxychromen-2-one.
What is the SMILES notation for 7-[[1-[(2,6-difluorophenyl)methyl]pyridin-1-ium-4-yl]methoxy]-6-methoxychromen-2-one?
The canonical SMILES for 7-[[1-[(2,6-difluorophenyl)methyl]pyridin-1-ium-4-yl]methoxy]-6-methoxychromen-2-one is COc1cc2ccc(=O)oc2cc1OCc1cc[n+](Cc2c(F)cccc2F)cc1.
What is the InChIKey of 7-[[1-[(2,6-difluorophenyl)methyl]pyridin-1-ium-4-yl]methoxy]-6-methoxychromen-2-one?
The InChIKey is CGPMITNBBOGYGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18F2NO4/c1-28-21-11-16-5-6-23(27)30-20(16)12-22(21)29-14-15-7-9-26(10-8-15)13-17-18(24)3-2-4-19(17)25/h2-12H,13-14H2,1H3/q+1.
What are the key properties of 7-[[1-[(2,6-difluorophenyl)methyl]pyridin-1-ium-4-yl]methoxy]-6-methoxychromen-2-one?
7-[[1-[(2,6-difluorophenyl)methyl]pyridin-1-ium-4-yl]methoxy]-6-methoxychromen-2-one has a molecular weight of 410.40 g/mol, XLogP of 3.99, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[[1-[(2,6-difluorophenyl)methyl]pyridin-1-ium-4-yl]methoxy]-6-methoxychromen-2-one is sourced from PubChem (CID 118988688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).