C20H17Cl2FN6S — CID 118988691
3-(2,6-dichloro-3-fluorophenyl)sulfanyl-5-(1-piperidin-4-ylpyrazol-4-yl)-1H-pyrazolo[5,4-b]pyridine (PubChem CID 118988691) has the molecular formula C20H17Cl2FN6S and a molecular weight of 463.37 g/mol. Its IUPAC name is 3-(2,6-dichloro-3-fluorophenyl)sulfanyl-5-(1-piperidin-4-ylpyrazol-4-yl)-1H-pyrazolo[5,4-b]pyridine.
| Compound Name | 3-(2,6-dichloro-3-fluorophenyl)sulfanyl-5-(1-piperidin-4-ylpyrazol-4-yl)-1H-pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 118988691 |
| Molecular Formula | C20H17Cl2FN6S |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 3-(2,6-dichloro-3-fluorophenyl)sulfanyl-5-(1-piperidin-4-ylpyrazol-4-yl)-1H-pyrazolo[5,4-b]pyridine |
| SMILES | Fc1ccc(Cl)c(Sc2n[nH]c3ncc(-c4cnn(C5CCNCC5)c4)cc23)c1Cl |
| InChI | InChI=1S/C20H17Cl2FN6S/c21-15-1-2-16(23)17(22)18(15)30-20-14-7-11(8-25-19(14)27-28-20)12-9-26-29(10-12)13-3-5-24-6-4-13/h1-2,7-10,13,24H,3-6H2,(H,25,27,28) |
| InChIKey | FCLVBOUURHAHBG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|