C23H21Cl2FN6 — CID 118988692
3-[1-(2,6-dichloro-3-fluorophenyl)cyclopropyl]-5-(1-piperidin-4-ylpyrazol-4-yl)-2H-pyrazolo[3,4-b]pyridine (PubChem CID 118988692) has the molecular formula C23H21Cl2FN6 and a molecular weight of 471.37 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)cyclopropyl]-5-(1-piperidin-4-ylpyrazol-4-yl)-2H-pyrazolo[3,4-b]pyridine.
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)cyclopropyl]-5-(1-piperidin-4-ylpyrazol-4-yl)-2H-pyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 118988692 |
| Molecular Formula | C23H21Cl2FN6 |
| Molecular Weight | 471.37 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)cyclopropyl]-5-(1-piperidin-4-ylpyrazol-4-yl)-2H-pyrazolo[3,4-b]pyridine |
| SMILES | Fc1ccc(Cl)c(C2(c3[nH]nc4ncc(-c5cnn(C6CCNCC6)c5)cc34)CC2)c1Cl |
| InChI | InChI=1S/C23H21Cl2FN6/c24-17-1-2-18(26)20(25)19(17)23(5-6-23)21-16-9-13(10-28-22(16)31-30-21)14-11-29-32(12-14)15-3-7-27-8-4-15/h1-2,9-12,15,27H,3-8H2,(H,28,30,31) |
| InChIKey | LQNBQZBDXDIOSM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.37 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|