C21H29NO3 — CID 118989081
(2R)-2-hydroxy-4-phenylbutanoic acid;(2S)-3-methyl-2-phenylbutan-1-amine (PubChem CID 118989081) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is (2R)-2-hydroxy-4-phenylbutanoic acid;(2S)-3-methyl-2-phenylbutan-1-amine.
| Compound Name | (2R)-2-hydroxy-4-phenylbutanoic acid;(2S)-3-methyl-2-phenylbutan-1-amine |
|---|---|
| PubChem CID | 118989081 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | (2R)-2-hydroxy-4-phenylbutanoic acid;(2S)-3-methyl-2-phenylbutan-1-amine |
| SMILES | CC(C)[C@H](CN)c1ccccc1.O=C(O)[C@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C11H17N.C10H12O3/c1-9(2)11(8-12)10-6-4-3-5-7-10;11-9(10(12)13)7-6-8-4-2-1-3-5-8/h3-7,9,11H,8,12H2,1-2H3;1-5,9,11H,6-7H2,(H,12,13)/t11-;9-/m01/s1 |
| InChIKey | STWWJQZJZVKVOV-FFJJHQGUSA-N |
| XLogP | 3.45 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |