C15H25GaN4O9 — CID 118989388
gallium 10-(1,3,4-trihydroxybutan-2-yl)-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate (PubChem CID 118989388) has the molecular formula C15H25GaN4O9 and a molecular weight of 475.11 g/mol. Its IUPAC name is gallium 10-(1,3,4-trihydroxybutan-2-yl)-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate.
| Compound Name | gallium 10-(1,3,4-trihydroxybutan-2-yl)-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
|---|---|
| PubChem CID | 118989388 |
| Molecular Formula | C15H25GaN4O9 |
| Molecular Weight | 475.11 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | gallium 10-(1,3,4-trihydroxybutan-2-yl)-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
| SMILES | O=C([O-])N1CCN(C(=O)[O-])CCN(C(CO)C(O)CO)CCN(C(=O)[O-])CC1.[Ga+3] |
| InChI | InChI=1S/C15H28N4O9.Ga/c20-9-11(12(22)10-21)16-1-3-17(13(23)24)5-7-19(15(27)28)8-6-18(4-2-16)14(25)26;/h11-12,20-22H,1-10H2,(H,23,24)(H,25,26)(H,27,28);/q;+3/p-3 |
| InChIKey | NMVNSVAWXBUTGC-UHFFFAOYSA-K |
| XLogP | -6.43 |
| TPSA | 194.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.11 |
| LogP ≤ 5 | -6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |