About tert-butyl N-amino-N-[(3S)-piperidine-3-carbonyl]carbamate
tert-butyl N-amino-N-[(3S)-piperidine-3-carbonyl]carbamate (PubChem CID 118989717) has the molecular formula C11H21N3O3
and a molecular weight of 243.31 g/mol. Its IUPAC name is tert-butyl N-amino-N-[(3S)-piperidine-3-carbonyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-amino-N-[(3S)-piperidine-3-carbonyl]carbamate |
| PubChem CID | 118989717 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | tert-butyl N-amino-N-[(3S)-piperidine-3-carbonyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(N)C(=O)[C@H]1CCCNC1 |
| InChI | InChI=1S/C11H21N3O3/c1-11(2,3)17-10(16)14(12)9(15)8-5-4-6-13-7-8/h8,13H,4-7,12H2,1-3H3/t8-/m0/s1 |
| InChIKey | GEGFFAGXPQNRIC-QMMMGPOBSA-N |
| XLogP | 0.62 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-amino-N-[(3S)-piperidine-3-carbonyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-amino-N-[(3S)-piperidine-3-carbonyl]carbamate?
The IUPAC name of tert-butyl N-amino-N-[(3S)-piperidine-3-carbonyl]carbamate (CID 118989717) is tert-butyl N-amino-N-[(3S)-piperidine-3-carbonyl]carbamate.
What is the SMILES notation for tert-butyl N-amino-N-[(3S)-piperidine-3-carbonyl]carbamate?
The canonical SMILES for tert-butyl N-amino-N-[(3S)-piperidine-3-carbonyl]carbamate is CC(C)(C)OC(=O)N(N)C(=O)[C@H]1CCCNC1.
What is the InChIKey of tert-butyl N-amino-N-[(3S)-piperidine-3-carbonyl]carbamate?
The InChIKey is GEGFFAGXPQNRIC-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H21N3O3/c1-11(2,3)17-10(16)14(12)9(15)8-5-4-6-13-7-8/h8,13H,4-7,12H2,1-3H3/t8-/m0/s1.
What are the key properties of tert-butyl N-amino-N-[(3S)-piperidine-3-carbonyl]carbamate?
tert-butyl N-amino-N-[(3S)-piperidine-3-carbonyl]carbamate has a molecular weight of 243.31 g/mol, XLogP of 0.62, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-amino-N-[(3S)-piperidine-3-carbonyl]carbamate is sourced from PubChem (CID 118989717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).