C14H19BN2O3 — CID 118989915
5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dihydrobenzimidazol-2-one (PubChem CID 118989915) has the molecular formula C14H19BN2O3 and a molecular weight of 274.13 g/mol. Its IUPAC name is 5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 118989915 |
| Molecular Formula | C14H19BN2O3 |
| Molecular Weight | 274.13 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dihydrobenzimidazol-2-one |
| SMILES | Cc1ccc2[nH]c(=O)[nH]c2c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H19BN2O3/c1-8-6-7-9-11(17-12(18)16-9)10(8)15-19-13(2,3)14(4,5)20-15/h6-7H,1-5H3,(H2,16,17,18) |
| InChIKey | ORYWBYPFXNIJBT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 67.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.13 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|