C11H2F7N — CID 118991508
2,6-difluoro-3-(2,3,4,5,6-pentafluorophenyl)pyridine (PubChem CID 118991508) has the molecular formula C11H2F7N and a molecular weight of 281.13 g/mol. Its IUPAC name is 2,6-difluoro-3-(2,3,4,5,6-pentafluorophenyl)pyridine.
| Compound Name | 2,6-difluoro-3-(2,3,4,5,6-pentafluorophenyl)pyridine |
|---|---|
| PubChem CID | 118991508 |
| Molecular Formula | C11H2F7N |
| Molecular Weight | 281.13 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 2,6-difluoro-3-(2,3,4,5,6-pentafluorophenyl)pyridine |
| SMILES | Fc1ccc(-c2c(F)c(F)c(F)c(F)c2F)c(F)n1 |
| InChI | InChI=1S/C11H2F7N/c12-4-2-1-3(11(18)19-4)5-6(13)8(15)10(17)9(16)7(5)14/h1-2H |
| InChIKey | UHJXWGCLBQKNRR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.13 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|