About 4-chloro-5-iodo-2,7-dimethylpyrrolo[2,3-d]pyrimidine
4-chloro-5-iodo-2,7-dimethylpyrrolo[2,3-d]pyrimidine (PubChem CID 118992935) has the molecular formula C8H7ClIN3
and a molecular weight of 307.52 g/mol. Its IUPAC name is 4-chloro-5-iodo-2,7-dimethylpyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-chloro-5-iodo-2,7-dimethylpyrrolo[2,3-d]pyrimidine |
| PubChem CID | 118992935 |
| Molecular Formula | C8H7ClIN3 |
| Molecular Weight | 307.52 g/mol |
| Exact Mass | 306.94 |
| IUPAC Name | 4-chloro-5-iodo-2,7-dimethylpyrrolo[2,3-d]pyrimidine |
| SMILES | Cc1nc(Cl)c2c(I)cn(C)c2n1 |
| InChI | InChI=1S/C8H7ClIN3/c1-4-11-7(9)6-5(10)3-13(2)8(6)12-4/h3H,1-2H3 |
| InChIKey | LUTVHBOBKKEWGM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-5-iodo-2,7-dimethylpyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-iodo-2,7-dimethylpyrrolo[2,3-d]pyrimidine?
The IUPAC name of 4-chloro-5-iodo-2,7-dimethylpyrrolo[2,3-d]pyrimidine (CID 118992935) is 4-chloro-5-iodo-2,7-dimethylpyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 4-chloro-5-iodo-2,7-dimethylpyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 4-chloro-5-iodo-2,7-dimethylpyrrolo[2,3-d]pyrimidine is Cc1nc(Cl)c2c(I)cn(C)c2n1.
What is the InChIKey of 4-chloro-5-iodo-2,7-dimethylpyrrolo[2,3-d]pyrimidine?
The InChIKey is LUTVHBOBKKEWGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClIN3/c1-4-11-7(9)6-5(10)3-13(2)8(6)12-4/h3H,1-2H3.
What are the key properties of 4-chloro-5-iodo-2,7-dimethylpyrrolo[2,3-d]pyrimidine?
4-chloro-5-iodo-2,7-dimethylpyrrolo[2,3-d]pyrimidine has a molecular weight of 307.52 g/mol, XLogP of 2.53, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-iodo-2,7-dimethylpyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 118992935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).