C24H29F3N3+ — CID 11899305
(4aR,8aR,9aR,10aS)-9-methyl-10-[[2-(trifluoromethyl)phenyl]methyl]-1,2,3,4,5,6,7,8,8a,9,9a,10-dodecahydroacridin-10-ium-4a,10a-dicarbonitrile (PubChem CID 11899305) has the molecular formula C24H29F3N3+ and a molecular weight of 416.51 g/mol. Its IUPAC name is (4aR,8aR,9aR,10aS)-9-methyl-10-[[2-(trifluoromethyl)phenyl]methyl]-1,2,3,4,5,6,7,8,8a,9,9a,10-dodecahydroacridin-10-ium-4a,10a-dicarbonitrile.
| Compound Name | (4aR,8aR,9aR,10aS)-9-methyl-10-[[2-(trifluoromethyl)phenyl]methyl]-1,2,3,4,5,6,7,8,8a,9,9a,10-dodecahydroacridin-10-ium-4a,10a-dicarbonitrile |
|---|---|
| PubChem CID | 11899305 |
| Molecular Formula | C24H29F3N3+ |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | (4aR,8aR,9aR,10aS)-9-methyl-10-[[2-(trifluoromethyl)phenyl]methyl]-1,2,3,4,5,6,7,8,8a,9,9a,10-dodecahydroacridin-10-ium-4a,10a-dicarbonitrile |
| SMILES | CC1[C@H]2CCCC[C@]2(C#N)[NH+](Cc2ccccc2C(F)(F)F)[C@]2(C#N)CCCC[C@H]12 |
| InChI | InChI=1S/C24H28F3N3/c1-17-19-9-4-6-12-22(19,15-28)30(23(16-29)13-7-5-10-20(17)23)14-18-8-2-3-11-21(18)24(25,26)27/h2-3,8,11,17,19-20H,4-7,9-10,12-14H2,1H3/p+1/t17?,19-,20-,22-,23+/m1/s1 |
| InChIKey | SOTMWCFQLUSXKP-PSKFWPKQSA-O |
| XLogP | 4.65 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |