methyl 5-(1,3-thiazol-2-yl)pyridine-2-carboxylate

C10H8N2O2S — CID 118993822

IUPACmethyl 5-(1,3-thiazol-2-yl)pyridine-2-carboxylate
SMILESCOC(=O)c1ccc(-c2nccs2)cn1
InChIInChI=1S/C10H8N2O2S/c1-14-10(13)8-3-2-7(6-12-8)9-11-4-5-15-9/h2-6H,1H3
InChIKeyDTCFYORGOSQJMK-UHFFFAOYSA-N
MW220.25 g/mol
LogP1.99
Rot. Bonds2

About methyl 5-(1,3-thiazol-2-yl)pyridine-2-carboxylate

methyl 5-(1,3-thiazol-2-yl)pyridine-2-carboxylate (PubChem CID 118993822) has the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. Its IUPAC name is methyl 5-(1,3-thiazol-2-yl)pyridine-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-(1,3-thiazol-2-yl)pyridine-2-carboxylate
PubChem CID118993822
Molecular FormulaC10H8N2O2S
Molecular Weight220.25 g/mol
Exact Mass220.03
IUPAC Namemethyl 5-(1,3-thiazol-2-yl)pyridine-2-carboxylate
SMILESCOC(=O)c1ccc(-c2nccs2)cn1
InChIInChI=1S/C10H8N2O2S/c1-14-10(13)8-3-2-7(6-12-8)9-11-4-5-15-9/h2-6H,1H3
InChIKeyDTCFYORGOSQJMK-UHFFFAOYSA-N
XLogP1.99
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.25
LogP ≤ 51.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 5-(1,3-thiazol-2-yl)pyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(1,3-thiazol-2-yl)pyridine-2-carboxylate?
The IUPAC name of methyl 5-(1,3-thiazol-2-yl)pyridine-2-carboxylate (CID 118993822) is methyl 5-(1,3-thiazol-2-yl)pyridine-2-carboxylate.
What is the SMILES notation for methyl 5-(1,3-thiazol-2-yl)pyridine-2-carboxylate?
The canonical SMILES for methyl 5-(1,3-thiazol-2-yl)pyridine-2-carboxylate is COC(=O)c1ccc(-c2nccs2)cn1.
What is the InChIKey of methyl 5-(1,3-thiazol-2-yl)pyridine-2-carboxylate?
The InChIKey is DTCFYORGOSQJMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2S/c1-14-10(13)8-3-2-7(6-12-8)9-11-4-5-15-9/h2-6H,1H3.
What are the key properties of methyl 5-(1,3-thiazol-2-yl)pyridine-2-carboxylate?
methyl 5-(1,3-thiazol-2-yl)pyridine-2-carboxylate has a molecular weight of 220.25 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(1,3-thiazol-2-yl)pyridine-2-carboxylate is sourced from PubChem (CID 118993822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).