C15H24N4O7 — CID 118994113
tert-butyl N-(3-methyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-2-yl)carbamate;oxalic acid (PubChem CID 118994113) has the molecular formula C15H24N4O7 and a molecular weight of 372.38 g/mol. Its IUPAC name is tert-butyl N-(3-methyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-2-yl)carbamate;oxalic acid.
| Compound Name | tert-butyl N-(3-methyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-2-yl)carbamate;oxalic acid |
|---|---|
| PubChem CID | 118994113 |
| Molecular Formula | C15H24N4O7 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | tert-butyl N-(3-methyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-2-yl)carbamate;oxalic acid |
| SMILES | CN1C(=O)C2(CCNCC2)N=C1NC(=O)OC(C)(C)C.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H22N4O3.C2H2O4/c1-12(2,3)20-11(19)15-10-16-13(9(18)17(10)4)5-7-14-8-6-13;3-1(4)2(5)6/h14H,5-8H2,1-4H3,(H,15,16,19);(H,3,4)(H,5,6) |
| InChIKey | YDUSSLXUWRLOQQ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 157.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|