C12H4Cl4N2 — CID 118994258
2-chloro-5-(3,4,5-trichlorophenyl)pyridine-3-carbonitrile (PubChem CID 118994258) has the molecular formula C12H4Cl4N2 and a molecular weight of 317.99 g/mol. Its IUPAC name is 2-chloro-5-(3,4,5-trichlorophenyl)pyridine-3-carbonitrile.
| Compound Name | 2-chloro-5-(3,4,5-trichlorophenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 118994258 |
| Molecular Formula | C12H4Cl4N2 |
| Molecular Weight | 317.99 g/mol |
| Exact Mass | 315.91 |
| IUPAC Name | 2-chloro-5-(3,4,5-trichlorophenyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1cc(-c2cc(Cl)c(Cl)c(Cl)c2)cnc1Cl |
| InChI | InChI=1S/C12H4Cl4N2/c13-9-2-6(3-10(14)11(9)15)8-1-7(4-17)12(16)18-5-8/h1-3,5H |
| InChIKey | YQZDDGMHECESDZ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.99 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|