C13H18ClN3O — CID 118994261
(3aR,7aS)-3-methyl-1-phenyl-3a,4,5,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one;hydrochloride (PubChem CID 118994261) has the molecular formula C13H18ClN3O and a molecular weight of 267.76 g/mol. Its IUPAC name is (3aR,7aS)-3-methyl-1-phenyl-3a,4,5,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one;hydrochloride.
| Compound Name | (3aR,7aS)-3-methyl-1-phenyl-3a,4,5,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one;hydrochloride |
|---|---|
| PubChem CID | 118994261 |
| Molecular Formula | C13H18ClN3O |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | (3aR,7aS)-3-methyl-1-phenyl-3a,4,5,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one;hydrochloride |
| SMILES | CN1C(=O)N(c2ccccc2)[C@H]2CCNC[C@H]21.Cl |
| InChI | InChI=1S/C13H17N3O.ClH/c1-15-12-9-14-8-7-11(12)16(13(15)17)10-5-3-2-4-6-10;/h2-6,11-12,14H,7-9H2,1H3;1H/t11-,12+;/m0./s1 |
| InChIKey | ADUOKLJQWBOHLG-ZVWHLABXSA-N |
| XLogP | 1.71 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |