2-(2-amino-5-fluoro-3-pyridinyl)acetic acid

C7H7FN2O2 — CID 118995801

IUPAC2-(2-amino-5-fluoro-3-pyridinyl)acetic acid
SMILESNc1ncc(F)cc1CC(=O)O
InChIInChI=1S/C7H7FN2O2/c8-5-1-4(2-6(11)12)7(9)10-3-5/h1,3H,2H2,(H2,9,10)(H,11,12)
InChIKeyNSBXUBPHEXHUHF-UHFFFAOYSA-N
MW170.14 g/mol
LogP0.43
Rot. Bonds2

About 2-(2-amino-5-fluoro-3-pyridinyl)acetic acid

2-(2-amino-5-fluoro-3-pyridinyl)acetic acid (PubChem CID 118995801) has the molecular formula C7H7FN2O2 and a molecular weight of 170.14 g/mol. Its IUPAC name is 2-(2-amino-5-fluoro-3-pyridinyl)acetic acid.

Molecular Properties

Compound Name2-(2-amino-5-fluoro-3-pyridinyl)acetic acid
PubChem CID118995801
Molecular FormulaC7H7FN2O2
Molecular Weight170.14 g/mol
Exact Mass170.05
IUPAC Name2-(2-amino-5-fluoro-3-pyridinyl)acetic acid
SMILESNc1ncc(F)cc1CC(=O)O
InChIInChI=1S/C7H7FN2O2/c8-5-1-4(2-6(11)12)7(9)10-3-5/h1,3H,2H2,(H2,9,10)(H,11,12)
InChIKeyNSBXUBPHEXHUHF-UHFFFAOYSA-N
XLogP0.43
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.14
LogP ≤ 50.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(2-amino-5-fluoro-3-pyridinyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-amino-5-fluoro-3-pyridinyl)acetic acid?
The IUPAC name of 2-(2-amino-5-fluoro-3-pyridinyl)acetic acid (CID 118995801) is 2-(2-amino-5-fluoro-3-pyridinyl)acetic acid.
What is the SMILES notation for 2-(2-amino-5-fluoro-3-pyridinyl)acetic acid?
The canonical SMILES for 2-(2-amino-5-fluoro-3-pyridinyl)acetic acid is Nc1ncc(F)cc1CC(=O)O.
What is the InChIKey of 2-(2-amino-5-fluoro-3-pyridinyl)acetic acid?
The InChIKey is NSBXUBPHEXHUHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FN2O2/c8-5-1-4(2-6(11)12)7(9)10-3-5/h1,3H,2H2,(H2,9,10)(H,11,12).
What are the key properties of 2-(2-amino-5-fluoro-3-pyridinyl)acetic acid?
2-(2-amino-5-fluoro-3-pyridinyl)acetic acid has a molecular weight of 170.14 g/mol, XLogP of 0.43, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-5-fluoro-3-pyridinyl)acetic acid is sourced from PubChem (CID 118995801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).