C7H7FN2O2 — CID 118995801
2-(2-amino-5-fluoro-3-pyridinyl)acetic acid (PubChem CID 118995801) has the molecular formula C7H7FN2O2 and a molecular weight of 170.14 g/mol. Its IUPAC name is 2-(2-amino-5-fluoro-3-pyridinyl)acetic acid.
| Compound Name | 2-(2-amino-5-fluoro-3-pyridinyl)acetic acid |
|---|---|
| PubChem CID | 118995801 |
| Molecular Formula | C7H7FN2O2 |
| Molecular Weight | 170.14 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 2-(2-amino-5-fluoro-3-pyridinyl)acetic acid |
| SMILES | Nc1ncc(F)cc1CC(=O)O |
| InChI | InChI=1S/C7H7FN2O2/c8-5-1-4(2-6(11)12)7(9)10-3-5/h1,3H,2H2,(H2,9,10)(H,11,12) |
| InChIKey | NSBXUBPHEXHUHF-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.14 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |