C12H5Cl3F3NO2 — CID 118996639
4-hydroxy-3-(3,4,5-trichlorophenyl)-6-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 118996639) has the molecular formula C12H5Cl3F3NO2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 4-hydroxy-3-(3,4,5-trichlorophenyl)-6-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 4-hydroxy-3-(3,4,5-trichlorophenyl)-6-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118996639 |
| Molecular Formula | C12H5Cl3F3NO2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 356.93 |
| IUPAC Name | 4-hydroxy-3-(3,4,5-trichlorophenyl)-6-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]c(C(F)(F)F)cc(O)c1-c1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H5Cl3F3NO2/c13-5-1-4(2-6(14)10(5)15)9-7(20)3-8(12(16,17)18)19-11(9)21/h1-3H,(H2,19,20,21) |
| InChIKey | IBOSHDZXMDDTCO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|