About trifluoro-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)boranuide
trifluoro-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)boranuide (PubChem CID 118996706) has the molecular formula C7H9BF3N2S-
and a molecular weight of 221.04 g/mol. Its IUPAC name is trifluoro-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)boranuide.
Molecular Properties
| Compound Name | trifluoro-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)boranuide |
| PubChem CID | 118996706 |
| Molecular Formula | C7H9BF3N2S- |
| Molecular Weight | 221.04 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | trifluoro-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)boranuide |
| SMILES | F[B-](F)(F)c1csc(N2CCCC2)n1 |
| InChI | InChI=1S/C7H9BF3N2S/c9-8(10,11)6-5-14-7(12-6)13-3-1-2-4-13/h5H,1-4H2/q-1 |
| InChIKey | IWTJFVFAXWYUHM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.04 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trifluoro-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trifluoro-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)boranuide?
The IUPAC name of trifluoro-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)boranuide (CID 118996706) is trifluoro-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)boranuide.
What is the SMILES notation for trifluoro-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)boranuide?
The canonical SMILES for trifluoro-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)boranuide is F[B-](F)(F)c1csc(N2CCCC2)n1.
What is the InChIKey of trifluoro-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)boranuide?
The InChIKey is IWTJFVFAXWYUHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BF3N2S/c9-8(10,11)6-5-14-7(12-6)13-3-1-2-4-13/h5H,1-4H2/q-1.
What are the key properties of trifluoro-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)boranuide?
trifluoro-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)boranuide has a molecular weight of 221.04 g/mol, XLogP of 1.80, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trifluoro-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)boranuide is sourced from PubChem (CID 118996706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).