About 2-bromo-7-(bromomethyl)-1,3-benzoxazole
2-bromo-7-(bromomethyl)-1,3-benzoxazole (PubChem CID 118997386) has the molecular formula C8H5Br2NO
and a molecular weight of 290.94 g/mol. Its IUPAC name is 2-bromo-7-(bromomethyl)-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-bromo-7-(bromomethyl)-1,3-benzoxazole |
| PubChem CID | 118997386 |
| Molecular Formula | C8H5Br2NO |
| Molecular Weight | 290.94 g/mol |
| Exact Mass | 288.87 |
| IUPAC Name | 2-bromo-7-(bromomethyl)-1,3-benzoxazole |
| SMILES | BrCc1cccc2nc(Br)oc12 |
| InChI | InChI=1S/C8H5Br2NO/c9-4-5-2-1-3-6-7(5)12-8(10)11-6/h1-3H,4H2 |
| InChIKey | AFBNNCNQKFVCHI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.94 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-7-(bromomethyl)-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-7-(bromomethyl)-1,3-benzoxazole?
The IUPAC name of 2-bromo-7-(bromomethyl)-1,3-benzoxazole (CID 118997386) is 2-bromo-7-(bromomethyl)-1,3-benzoxazole.
What is the SMILES notation for 2-bromo-7-(bromomethyl)-1,3-benzoxazole?
The canonical SMILES for 2-bromo-7-(bromomethyl)-1,3-benzoxazole is BrCc1cccc2nc(Br)oc12.
What is the InChIKey of 2-bromo-7-(bromomethyl)-1,3-benzoxazole?
The InChIKey is AFBNNCNQKFVCHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Br2NO/c9-4-5-2-1-3-6-7(5)12-8(10)11-6/h1-3H,4H2.
What are the key properties of 2-bromo-7-(bromomethyl)-1,3-benzoxazole?
2-bromo-7-(bromomethyl)-1,3-benzoxazole has a molecular weight of 290.94 g/mol, XLogP of 3.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-7-(bromomethyl)-1,3-benzoxazole is sourced from PubChem (CID 118997386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).