About 4,6-dibromo-2,3-dihydro-1H-indole
4,6-dibromo-2,3-dihydro-1H-indole (PubChem CID 118997689) has the molecular formula C8H7Br2N
and a molecular weight of 276.96 g/mol. Its IUPAC name is 4,6-dibromo-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 4,6-dibromo-2,3-dihydro-1H-indole |
| PubChem CID | 118997689 |
| Molecular Formula | C8H7Br2N |
| Molecular Weight | 276.96 g/mol |
| Exact Mass | 274.89 |
| IUPAC Name | 4,6-dibromo-2,3-dihydro-1H-indole |
| SMILES | Brc1cc(Br)c2c(c1)NCC2 |
| InChI | InChI=1S/C8H7Br2N/c9-5-3-7(10)6-1-2-11-8(6)4-5/h3-4,11H,1-2H2 |
| InChIKey | BMSSXPUHKOOGRM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.96 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,6-dibromo-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dibromo-2,3-dihydro-1H-indole?
The IUPAC name of 4,6-dibromo-2,3-dihydro-1H-indole (CID 118997689) is 4,6-dibromo-2,3-dihydro-1H-indole.
What is the SMILES notation for 4,6-dibromo-2,3-dihydro-1H-indole?
The canonical SMILES for 4,6-dibromo-2,3-dihydro-1H-indole is Brc1cc(Br)c2c(c1)NCC2.
What is the InChIKey of 4,6-dibromo-2,3-dihydro-1H-indole?
The InChIKey is BMSSXPUHKOOGRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Br2N/c9-5-3-7(10)6-1-2-11-8(6)4-5/h3-4,11H,1-2H2.
What are the key properties of 4,6-dibromo-2,3-dihydro-1H-indole?
4,6-dibromo-2,3-dihydro-1H-indole has a molecular weight of 276.96 g/mol, XLogP of 3.18, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dibromo-2,3-dihydro-1H-indole is sourced from PubChem (CID 118997689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).